C24H26ClN5O3S — CID 171795151
2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 171795151) has the molecular formula C24H26ClN5O3S and a molecular weight of 500.02 g/mol. Its IUPAC name is 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 171795151 |
| Molecular Formula | C24H26ClN5O3S |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NOC1CCCCO1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C24H26ClN5O3S/c1-13-14(2)34-24-21(13)22(16-7-9-17(25)10-8-16)26-18(23-28-27-15(3)30(23)24)12-19(31)29-33-20-6-4-5-11-32-20/h7-10,18,20H,4-6,11-12H2,1-3H3,(H,29,31)/t18-,20?/m0/s1 |
| InChIKey | CQLICYLXIDJQHN-LROBGIAVSA-N |
| XLogP | 4.76 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|