C28H28ClN5O2 — CID 171795952
1-[4-[3-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-pyridinyl]-2-hydroxyphenyl]-2-chlorophenyl]-3-methylimidazol-2-one (PubChem CID 171795952) has the molecular formula C28H28ClN5O2 and a molecular weight of 502.02 g/mol. Its IUPAC name is 1-[4-[3-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-pyridinyl]-2-hydroxyphenyl]-2-chlorophenyl]-3-methylimidazol-2-one.
| Compound Name | 1-[4-[3-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-pyridinyl]-2-hydroxyphenyl]-2-chlorophenyl]-3-methylimidazol-2-one |
|---|---|
| PubChem CID | 171795952 |
| Molecular Formula | C28H28ClN5O2 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 1-[4-[3-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-pyridinyl]-2-hydroxyphenyl]-2-chlorophenyl]-3-methylimidazol-2-one |
| SMILES | Cn1ccn(-c2ccc(-c3cccc(-c4ccnc(N5CCN6CCCC6C5)c4)c3O)cc2Cl)c1=O |
| InChI | InChI=1S/C28H28ClN5O2/c1-31-12-15-34(28(31)36)25-8-7-19(16-24(25)29)22-5-2-6-23(27(22)35)20-9-10-30-26(17-20)33-14-13-32-11-3-4-21(32)18-33/h2,5-10,12,15-17,21,35H,3-4,11,13-14,18H2,1H3 |
| InChIKey | RVRAIGQEGYOSPW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |