C11H11N3O2 — CID 171796577
N-[5-methyl-3-(1,2,4-oxadiazol-3-yl)cyclohepta-1,3,6-trien-1-yl]formamide (PubChem CID 171796577) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is N-[5-methyl-3-(1,2,4-oxadiazol-3-yl)cyclohepta-1,3,6-trien-1-yl]formamide.
| Compound Name | N-[5-methyl-3-(1,2,4-oxadiazol-3-yl)cyclohepta-1,3,6-trien-1-yl]formamide |
|---|---|
| PubChem CID | 171796577 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-[5-methyl-3-(1,2,4-oxadiazol-3-yl)cyclohepta-1,3,6-trien-1-yl]formamide |
| SMILES | CC1C=CC(NC=O)=CC(c2ncon2)=C1 |
| InChI | InChI=1S/C11H11N3O2/c1-8-2-3-10(12-6-15)5-9(4-8)11-13-7-16-14-11/h2-8H,1H3,(H,12,15) |
| InChIKey | ACZJDZQDYGGNOW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|