C43H40BrF3N2O5 — CID 171797953
[(3S,4S)-4-benzoyloxy-4-(3-benzoyloxyphenyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]piperidin-3-yl]methyl-benzyl-methyl-(trideuteriomethyl)azanium bromide (PubChem CID 171797953) has the molecular formula C43H40BrF3N2O5 and a molecular weight of 804.72 g/mol. Its IUPAC name is [(3S,4S)-4-benzoyloxy-4-(3-benzoyloxyphenyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]piperidin-3-yl]methyl-benzyl-methyl-(trideuteriomethyl)azanium bromide.
| Compound Name | [(3S,4S)-4-benzoyloxy-4-(3-benzoyloxyphenyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]piperidin-3-yl]methyl-benzyl-methyl-(trideuteriomethyl)azanium bromide |
|---|---|
| PubChem CID | 171797953 |
| Molecular Formula | C43H40BrF3N2O5 |
| Molecular Weight | 804.72 g/mol |
| Exact Mass | 803.23 |
| IUPAC Name | [(3S,4S)-4-benzoyloxy-4-(3-benzoyloxyphenyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]piperidin-3-yl]methyl-benzyl-methyl-(trideuteriomethyl)azanium bromide |
| SMILES | [2H]C([2H])([2H])[N+](C)(Cc1ccccc1)C[C@@H]1CN(C(=O)Cc2cc(F)c(F)cc2F)CC[C@@]1(OC(=O)c1ccccc1)c1cccc(OC(=O)c2ccccc2)c1.[Br-] |
| InChI | InChI=1S/C43H40F3N2O5.BrH/c1-48(2,28-30-13-6-3-7-14-30)29-35-27-47(40(49)24-33-23-38(45)39(46)26-37(33)44)22-21-43(35,53-42(51)32-17-10-5-11-18-32)34-19-12-20-36(25-34)52-41(50)31-15-8-4-9-16-31;/h3-20,23,25-26,35H,21-22,24,27-29H2,1-2H3;1H/q+1;/p-1/t35-,43+;/m0./s1/i1D3;/t35-,43+,48?; |
| InChIKey | GIXHIDLJYXTVAE-ZHAGTLHESA-M |
| XLogP | 4.75 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.72 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|