C28H38FN7O4 — CID 171798200
[1-(2-fluoroprop-2-enoyl)azetidin-3-yl] 5-[[5-(oxan-4-ylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 171798200) has the molecular formula C28H38FN7O4 and a molecular weight of 555.66 g/mol. Its IUPAC name is [1-(2-fluoroprop-2-enoyl)azetidin-3-yl] 5-[[5-(oxan-4-ylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | [1-(2-fluoroprop-2-enoyl)azetidin-3-yl] 5-[[5-(oxan-4-ylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 171798200 |
| Molecular Formula | C28H38FN7O4 |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | [1-(2-fluoroprop-2-enoyl)azetidin-3-yl] 5-[[5-(oxan-4-ylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | C=C(F)C(=O)N1CC(OC(=O)N2CC3CC(Nc4cc(NC5CCOCC5)nc5c(C(C)C)cnn45)CC3C2)C1 |
| InChI | InChI=1S/C28H38FN7O4/c1-16(2)23-11-30-36-25(10-24(33-26(23)36)31-20-4-6-39-7-5-20)32-21-8-18-12-35(13-19(18)9-21)28(38)40-22-14-34(15-22)27(37)17(3)29/h10-11,16,18-22,32H,3-9,12-15H2,1-2H3,(H,31,33) |
| InChIKey | GULPSSXAWROQME-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|