C22H30F3N7O3 — CID 171798229
pyrrolidin-3-yl 3-[[8-propan-2-yl-2-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171798229) has the molecular formula C22H30F3N7O3 and a molecular weight of 497.52 g/mol. Its IUPAC name is pyrrolidin-3-yl 3-[[8-propan-2-yl-2-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | pyrrolidin-3-yl 3-[[8-propan-2-yl-2-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171798229 |
| Molecular Formula | C22H30F3N7O3 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | pyrrolidin-3-yl 3-[[8-propan-2-yl-2-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)c1cnn2c(NC3CC4CCC(C3)N4C(=O)OC3CCNC3)nc(OCC(F)(F)F)nc12 |
| InChI | InChI=1S/C22H30F3N7O3/c1-12(2)17-10-27-32-18(17)29-20(34-11-22(23,24)25)30-19(32)28-13-7-14-3-4-15(8-13)31(14)21(33)35-16-5-6-26-9-16/h10,12-16,26H,3-9,11H2,1-2H3,(H,28,29,30) |
| InChIKey | SFCZOQJYJNHDKR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |