C18H20FN5O3 — CID 171799285
N-(2,2-dimethoxyethyl)-5-[5-(4-fluoro-3-methoxyphenyl)-1,2,4-triazol-1-yl]pyridin-2-amine (PubChem CID 171799285) has the molecular formula C18H20FN5O3 and a molecular weight of 373.39 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-5-[5-(4-fluoro-3-methoxyphenyl)-1,2,4-triazol-1-yl]pyridin-2-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-5-[5-(4-fluoro-3-methoxyphenyl)-1,2,4-triazol-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 171799285 |
| Molecular Formula | C18H20FN5O3 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-5-[5-(4-fluoro-3-methoxyphenyl)-1,2,4-triazol-1-yl]pyridin-2-amine |
| SMILES | COc1cc(-c2ncnn2-c2ccc(NCC(OC)OC)nc2)ccc1F |
| InChI | InChI=1S/C18H20FN5O3/c1-25-15-8-12(4-6-14(15)19)18-22-11-23-24(18)13-5-7-16(20-9-13)21-10-17(26-2)27-3/h4-9,11,17H,10H2,1-3H3,(H,20,21) |
| InChIKey | PVYOOEFIRKXVHL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|