About 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one
1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one (PubChem CID 171799346) has the molecular formula C17H13BrFN3O
and a molecular weight of 374.21 g/mol. Its IUPAC name is 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one |
| PubChem CID | 171799346 |
| Molecular Formula | C17H13BrFN3O |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one |
| SMILES | O=C1CCC(c2ccc(F)cc2)N1c1ccc2ncc(Br)n2c1 |
| InChI | InChI=1S/C17H13BrFN3O/c18-15-9-20-16-7-5-13(10-21(15)16)22-14(6-8-17(22)23)11-1-3-12(19)4-2-11/h1-5,7,9-10,14H,6,8H2 |
| InChIKey | XTNZNHYDFUVYFE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one?
The IUPAC name of 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one (CID 171799346) is 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one.
What is the SMILES notation for 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one?
The canonical SMILES for 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one is O=C1CCC(c2ccc(F)cc2)N1c1ccc2ncc(Br)n2c1.
What is the InChIKey of 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one?
The InChIKey is XTNZNHYDFUVYFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrFN3O/c18-15-9-20-16-7-5-13(10-21(15)16)22-14(6-8-17(22)23)11-1-3-12(19)4-2-11/h1-5,7,9-10,14H,6,8H2.
What are the key properties of 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one?
1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one has a molecular weight of 374.21 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromoimidazo[1,2-a]pyridin-6-yl)-5-(4-fluorophenyl)pyrrolidin-2-one is sourced from PubChem (CID 171799346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).