About 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol
1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol (PubChem CID 171800011) has the molecular formula C20H42N2O2S
and a molecular weight of 374.64 g/mol. Its IUPAC name is 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol.
Molecular Properties
| Compound Name | 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol |
| PubChem CID | 171800011 |
| Molecular Formula | C20H42N2O2S |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol |
| SMILES | CC(CCN(C)C)OCC1CCN(CCC(=O)C(C)C)CC1.CCS |
| InChI | InChI=1S/C18H36N2O2.C2H6S/c1-15(2)18(21)9-13-20-11-7-17(8-12-20)14-22-16(3)6-10-19(4)5;1-2-3/h15-17H,6-14H2,1-5H3;3H,2H2,1H3 |
| InChIKey | GOLUCEMOGRANGU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol?
The IUPAC name of 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol (CID 171800011) is 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol.
What is the SMILES notation for 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol?
The canonical SMILES for 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol is CC(CCN(C)C)OCC1CCN(CCC(=O)C(C)C)CC1.CCS.
What is the InChIKey of 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol?
The InChIKey is GOLUCEMOGRANGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2O2.C2H6S/c1-15(2)18(21)9-13-20-11-7-17(8-12-20)14-22-16(3)6-10-19(4)5;1-2-3/h15-17H,6-14H2,1-5H3;3H,2H2,1H3.
What are the key properties of 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol?
1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol has a molecular weight of 374.64 g/mol, XLogP of 3.61, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4-(dimethylamino)butan-2-yloxymethyl]piperidin-1-yl]-4-methylpentan-3-one;ethanethiol is sourced from PubChem (CID 171800011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).