C19H36N4 — CID 171800066
ethene;(3E)-3-ethylidene-4-methyl-5-[(E)-pent-1-enyl]pyrazin-2-amine;(2R)-N-methylbutan-2-amine (PubChem CID 171800066) has the molecular formula C19H36N4 and a molecular weight of 320.53 g/mol. Its IUPAC name is ethene;(3E)-3-ethylidene-4-methyl-5-[(E)-pent-1-enyl]pyrazin-2-amine;(2R)-N-methylbutan-2-amine.
| Compound Name | ethene;(3E)-3-ethylidene-4-methyl-5-[(E)-pent-1-enyl]pyrazin-2-amine;(2R)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 171800066 |
| Molecular Formula | C19H36N4 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | ethene;(3E)-3-ethylidene-4-methyl-5-[(E)-pent-1-enyl]pyrazin-2-amine;(2R)-N-methylbutan-2-amine |
| SMILES | C/C=C1\C(N)=NC=C(/C=C/CCC)N1C.C=C.CC[C@@H](C)NC |
| InChI | InChI=1S/C12H19N3.C5H13N.C2H4/c1-4-6-7-8-10-9-14-12(13)11(5-2)15(10)3;1-4-5(2)6-3;1-2/h5,7-9H,4,6H2,1-3H3,(H2,13,14);5-6H,4H2,1-3H3;1-2H2/b8-7+,11-5+;;/t;5-;/m.1./s1 |
| InChIKey | GRQWDNWDFDDRQL-WQEAOAPXSA-N |
| XLogP | 4.20 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|