C16H21NO3 — CID 171800890
ethenyl 3-[(2S)-2-aminopropoxy]-5,6,7,8-tetrahydronaphthalene-1-carboxylate (PubChem CID 171800890) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethenyl 3-[(2S)-2-aminopropoxy]-5,6,7,8-tetrahydronaphthalene-1-carboxylate.
| Compound Name | ethenyl 3-[(2S)-2-aminopropoxy]-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 171800890 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | ethenyl 3-[(2S)-2-aminopropoxy]-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
| SMILES | C=COC(=O)c1cc(OC[C@H](C)N)cc2c1CCCC2 |
| InChI | InChI=1S/C16H21NO3/c1-3-19-16(18)15-9-13(20-10-11(2)17)8-12-6-4-5-7-14(12)15/h3,8-9,11H,1,4-7,10,17H2,2H3/t11-/m0/s1 |
| InChIKey | ILFAMBUNTLDLES-NSHDSACASA-N |
| XLogP | 2.59 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|