C19H19N3O2 — CID 171801428
phenyl N-[4-[(1R)-1-(2-methylimidazol-1-yl)ethyl]phenyl]carbamate (PubChem CID 171801428) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is phenyl N-[4-[(1R)-1-(2-methylimidazol-1-yl)ethyl]phenyl]carbamate.
| Compound Name | phenyl N-[4-[(1R)-1-(2-methylimidazol-1-yl)ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 171801428 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | phenyl N-[4-[(1R)-1-(2-methylimidazol-1-yl)ethyl]phenyl]carbamate |
| SMILES | Cc1nccn1[C@H](C)c1ccc(NC(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N3O2/c1-14(22-13-12-20-15(22)2)16-8-10-17(11-9-16)21-19(23)24-18-6-4-3-5-7-18/h3-14H,1-2H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | OGNISHSKRVZTQS-CQSZACIVSA-N |
| XLogP | 4.41 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |