About 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine
2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine (PubChem CID 171802407) has the molecular formula C14H21FN6O2S
and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine.
Molecular Properties
| Compound Name | 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine |
| PubChem CID | 171802407 |
| Molecular Formula | C14H21FN6O2S |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(N[C@@H]3CN(S(C)(=O)=O)C[C@H]3C)nc(F)nc21 |
| InChI | InChI=1S/C14H21FN6O2S/c1-8(2)21-7-16-11-12(18-14(15)19-13(11)21)17-10-6-20(5-9(10)3)24(4,22)23/h7-10H,5-6H2,1-4H3,(H,17,18,19)/t9-,10-/m1/s1 |
| InChIKey | FBZFIYAEXPNGMA-NXEZZACHSA-N |
| XLogP | 1.24 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine?
The IUPAC name of 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine (CID 171802407) is 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine.
What is the SMILES notation for 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine?
The canonical SMILES for 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine is CC(C)n1cnc2c(N[C@@H]3CN(S(C)(=O)=O)C[C@H]3C)nc(F)nc21.
What is the InChIKey of 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine?
The InChIKey is FBZFIYAEXPNGMA-NXEZZACHSA-N. The full InChI is InChI=1S/C14H21FN6O2S/c1-8(2)21-7-16-11-12(18-14(15)19-13(11)21)17-10-6-20(5-9(10)3)24(4,22)23/h7-10H,5-6H2,1-4H3,(H,17,18,19)/t9-,10-/m1/s1.
What are the key properties of 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine?
2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine has a molecular weight of 356.43 g/mol, XLogP of 1.24, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[(3S,4R)-4-methyl-1-methylsulfonylpyrrolidin-3-yl]-9-propan-2-ylpurin-6-amine is sourced from PubChem (CID 171802407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).