C20H21BrF3NO5 — CID 171802924
2-O-tert-butyl 3-O-methyl 3-[(3-bromo-2,5-difluorophenyl)methyl]-5-fluoro-4-oxo-2-azabicyclo[3.1.1]heptane-2,3-dicarboxylate (PubChem CID 171802924) has the molecular formula C20H21BrF3NO5 and a molecular weight of 492.29 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-methyl 3-[(3-bromo-2,5-difluorophenyl)methyl]-5-fluoro-4-oxo-2-azabicyclo[3.1.1]heptane-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-methyl 3-[(3-bromo-2,5-difluorophenyl)methyl]-5-fluoro-4-oxo-2-azabicyclo[3.1.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 171802924 |
| Molecular Formula | C20H21BrF3NO5 |
| Molecular Weight | 492.29 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 2-O-tert-butyl 3-O-methyl 3-[(3-bromo-2,5-difluorophenyl)methyl]-5-fluoro-4-oxo-2-azabicyclo[3.1.1]heptane-2,3-dicarboxylate |
| SMILES | COC(=O)C1(Cc2cc(F)cc(Br)c2F)C(=O)C2(F)CC(C2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H21BrF3NO5/c1-18(2,3)30-17(28)25-12-8-19(24,9-12)15(26)20(25,16(27)29-4)7-10-5-11(22)6-13(21)14(10)23/h5-6,12H,7-9H2,1-4H3 |
| InChIKey | JPDXHRZPMWAXHR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|