C16H19BF3N3O3 — CID 171803378
5-(difluoromethyl)-N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,3,4-oxadiazol-2-amine (PubChem CID 171803378) has the molecular formula C16H19BF3N3O3 and a molecular weight of 369.15 g/mol. Its IUPAC name is 5-(difluoromethyl)-N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(difluoromethyl)-N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 171803378 |
| Molecular Formula | C16H19BF3N3O3 |
| Molecular Weight | 369.15 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 5-(difluoromethyl)-N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,3,4-oxadiazol-2-amine |
| SMILES | CC1(C)OB(c2ccc(CNc3nnc(C(F)F)o3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C16H19BF3N3O3/c1-15(2)16(3,4)26-17(25-15)10-6-5-9(11(18)7-10)8-21-14-23-22-13(24-14)12(19)20/h5-7,12H,8H2,1-4H3,(H,21,23) |
| InChIKey | LQZPGKGOWHEHJK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.15 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|