C20H23ClN4 — CID 171803484
2-[5-[(3E,5Z)-5-chloro-3,6-dimethylocta-1,3,5-trien-2-yl]-4-(methylideneamino)-1H-imidazol-2-yl]aniline (PubChem CID 171803484) has the molecular formula C20H23ClN4 and a molecular weight of 354.89 g/mol. Its IUPAC name is 2-[5-[(3E,5Z)-5-chloro-3,6-dimethylocta-1,3,5-trien-2-yl]-4-(methylideneamino)-1H-imidazol-2-yl]aniline.
| Compound Name | 2-[5-[(3E,5Z)-5-chloro-3,6-dimethylocta-1,3,5-trien-2-yl]-4-(methylideneamino)-1H-imidazol-2-yl]aniline |
|---|---|
| PubChem CID | 171803484 |
| Molecular Formula | C20H23ClN4 |
| Molecular Weight | 354.89 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-[5-[(3E,5Z)-5-chloro-3,6-dimethylocta-1,3,5-trien-2-yl]-4-(methylideneamino)-1H-imidazol-2-yl]aniline |
| SMILES | C=Nc1nc(-c2ccccc2N)[nH]c1C(=C)/C(C)=C/C(Cl)=C(\C)CC |
| InChI | InChI=1S/C20H23ClN4/c1-6-12(2)16(21)11-13(3)14(4)18-20(23-5)25-19(24-18)15-9-7-8-10-17(15)22/h7-11H,4-6,22H2,1-3H3,(H,24,25)/b13-11+,16-12- |
| InChIKey | DBYKIUWGBKLNDJ-DXHZZVMKSA-N |
| XLogP | 5.87 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.89 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|