C33H34F3N7O3 — CID 171803615
3-tert-butyl-N-[[4-[2-[5-(1,1-difluoroethyl)-2-(prop-2-enoylamino)phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]-2-fluorophenyl]methyl]-1,2,4-oxadiazole-5-carboxamide;ethane (PubChem CID 171803615) has the molecular formula C33H34F3N7O3 and a molecular weight of 633.68 g/mol. Its IUPAC name is 3-tert-butyl-N-[[4-[2-[5-(1,1-difluoroethyl)-2-(prop-2-enoylamino)phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]-2-fluorophenyl]methyl]-1,2,4-oxadiazole-5-carboxamide;ethane.
| Compound Name | 3-tert-butyl-N-[[4-[2-[5-(1,1-difluoroethyl)-2-(prop-2-enoylamino)phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]-2-fluorophenyl]methyl]-1,2,4-oxadiazole-5-carboxamide;ethane |
|---|---|
| PubChem CID | 171803615 |
| Molecular Formula | C33H34F3N7O3 |
| Molecular Weight | 633.68 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | 3-tert-butyl-N-[[4-[2-[5-(1,1-difluoroethyl)-2-(prop-2-enoylamino)phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]-2-fluorophenyl]methyl]-1,2,4-oxadiazole-5-carboxamide;ethane |
| SMILES | C=CC(=O)Nc1ccc(C(C)(F)F)cc1-c1nc2nccc(-c3ccc(CNC(=O)c4nc(C(C)(C)C)no4)c(F)c3)c2[nH]1.CC |
| InChI | InChI=1S/C31H28F3N7O3.C2H6/c1-6-23(42)37-22-10-9-18(31(5,33)34)14-20(22)25-38-24-19(11-12-35-26(24)39-25)16-7-8-17(21(32)13-16)15-36-27(43)28-40-29(41-44-28)30(2,3)4;1-2/h6-14H,1,15H2,2-5H3,(H,36,43)(H,37,42)(H,35,38,39);1-2H3 |
| InChIKey | ZSMBBWIEEOXNCO-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.68 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|