About ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine
ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine (PubChem CID 171804047) has the molecular formula C15H27F2N
and a molecular weight of 259.38 g/mol. Its IUPAC name is ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine.
Molecular Properties
| Compound Name | ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine |
| PubChem CID | 171804047 |
| Molecular Formula | C15H27F2N |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine |
| SMILES | C/C=C1C(=C/CC)\C(F)(F)CCN\1C(C)C.CC |
| InChI | InChI=1S/C13H21F2N.C2H6/c1-5-7-11-12(6-2)16(10(3)4)9-8-13(11,14)15;1-2/h6-7,10H,5,8-9H2,1-4H3;1-2H3/b11-7+,12-6+; |
| InChIKey | OLFXRHKGRXZWDL-ZSYKBTTMSA-N |
| XLogP | 5.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine?
The IUPAC name of ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine (CID 171804047) is ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine.
What is the SMILES notation for ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine?
The canonical SMILES for ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine is C/C=C1C(=C/CC)\C(F)(F)CCN\1C(C)C.CC.
What is the InChIKey of ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine?
The InChIKey is OLFXRHKGRXZWDL-ZSYKBTTMSA-N. The full InChI is InChI=1S/C13H21F2N.C2H6/c1-5-7-11-12(6-2)16(10(3)4)9-8-13(11,14)15;1-2/h6-7,10H,5,8-9H2,1-4H3;1-2H3/b11-7+,12-6+;.
What are the key properties of ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine?
ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine has a molecular weight of 259.38 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E,3E)-2-ethylidene-4,4-difluoro-1-propan-2-yl-3-propylidenepiperidine is sourced from PubChem (CID 171804047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).