C22H19NO6 — CID 171804089
3-[3-(1,3-benzodioxol-5-ylmethoxy)propyl]-2H-chromeno[4,3-b][1,4]oxazin-5-one (PubChem CID 171804089) has the molecular formula C22H19NO6 and a molecular weight of 393.40 g/mol. Its IUPAC name is 3-[3-(1,3-benzodioxol-5-ylmethoxy)propyl]-2H-chromeno[4,3-b][1,4]oxazin-5-one.
| Compound Name | 3-[3-(1,3-benzodioxol-5-ylmethoxy)propyl]-2H-chromeno[4,3-b][1,4]oxazin-5-one |
|---|---|
| PubChem CID | 171804089 |
| Molecular Formula | C22H19NO6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 3-[3-(1,3-benzodioxol-5-ylmethoxy)propyl]-2H-chromeno[4,3-b][1,4]oxazin-5-one |
| SMILES | O=c1oc2ccccc2c2c1N=C(CCCOCc1ccc3c(c1)OCO3)CO2 |
| InChI | InChI=1S/C22H19NO6/c24-22-20-21(16-5-1-2-6-17(16)29-22)26-12-15(23-20)4-3-9-25-11-14-7-8-18-19(10-14)28-13-27-18/h1-2,5-8,10H,3-4,9,11-13H2 |
| InChIKey | IEUGOHLSSLWCSI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|