C18H34N4O4SV — CID 171804479
2-[4-[2-(ethylamino)-2-oxoethyl]-7-(2-oxopentyl)-1,4,7-triazonan-1-yl]acetic acid;methanethiolate;vanadium(2+) (PubChem CID 171804479) has the molecular formula C18H34N4O4SV and a molecular weight of 453.51 g/mol. Its IUPAC name is 2-[4-[2-(ethylamino)-2-oxoethyl]-7-(2-oxopentyl)-1,4,7-triazonan-1-yl]acetic acid;methanethiolate;vanadium(2+).
| Compound Name | 2-[4-[2-(ethylamino)-2-oxoethyl]-7-(2-oxopentyl)-1,4,7-triazonan-1-yl]acetic acid;methanethiolate;vanadium(2+) |
|---|---|
| PubChem CID | 171804479 |
| Molecular Formula | C18H34N4O4SV |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-[4-[2-(ethylamino)-2-oxoethyl]-7-(2-oxopentyl)-1,4,7-triazonan-1-yl]acetic acid;methanethiolate;vanadium(2+) |
| SMILES | C[S-].[CH2-]CNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)CCC)CC1.[V+2] |
| InChI | InChI=1S/C17H31N4O4.CH4S.V/c1-3-5-15(22)12-19-6-8-20(13-16(23)18-4-2)9-11-21(10-7-19)14-17(24)25;1-2;/h2-14H2,1H3,(H,18,23)(H,24,25);2H,1H3;/q-1;;+2/p-1 |
| InChIKey | VGZBYNOIPBHXQZ-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|