C13H9F3IN3O — CID 171805223
8-iodo-4-methoxy-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indole (PubChem CID 171805223) has the molecular formula C13H9F3IN3O and a molecular weight of 407.13 g/mol. Its IUPAC name is 8-iodo-4-methoxy-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indole.
| Compound Name | 8-iodo-4-methoxy-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 171805223 |
| Molecular Formula | C13H9F3IN3O |
| Molecular Weight | 407.13 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | 8-iodo-4-methoxy-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indole |
| SMILES | COc1ncnc2c3cc(I)ccc3n(CC(F)(F)F)c12 |
| InChI | InChI=1S/C13H9F3IN3O/c1-21-12-11-10(18-6-19-12)8-4-7(17)2-3-9(8)20(11)5-13(14,15)16/h2-4,6H,5H2,1H3 |
| InChIKey | KEDATODBVYHSMO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.13 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|