About ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate
ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate (PubChem CID 171805438) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate.
Molecular Properties
| Compound Name | ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate |
| PubChem CID | 171805438 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate |
| SMILES | CC.CCNc1ccc(C)cc1C#N.CCOC=O |
| InChI | InChI=1S/C10H12N2.C3H6O2.C2H6/c1-3-12-10-5-4-8(2)6-9(10)7-11;1-2-5-3-4;1-2/h4-6,12H,3H2,1-2H3;3H,2H2,1H3;1-2H3 |
| InChIKey | GAENFRPMWLYYJL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate?
The IUPAC name of ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate (CID 171805438) is ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate.
What is the SMILES notation for ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate?
The canonical SMILES for ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate is CC.CCNc1ccc(C)cc1C#N.CCOC=O.
What is the InChIKey of ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate?
The InChIKey is GAENFRPMWLYYJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2.C3H6O2.C2H6/c1-3-12-10-5-4-8(2)6-9(10)7-11;1-2-5-3-4;1-2/h4-6,12H,3H2,1-2H3;3H,2H2,1H3;1-2H3.
What are the key properties of ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate?
ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate has a molecular weight of 264.37 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(ethylamino)-5-methylbenzonitrile;ethyl formate is sourced from PubChem (CID 171805438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).