C17H15ClF6N4O — CID 171805442
1-[4-chloro-2-(2,2,2-trifluoroethoxy)-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indol-8-yl]-N,N-dimethylmethanamine (PubChem CID 171805442) has the molecular formula C17H15ClF6N4O and a molecular weight of 440.78 g/mol. Its IUPAC name is 1-[4-chloro-2-(2,2,2-trifluoroethoxy)-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indol-8-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-chloro-2-(2,2,2-trifluoroethoxy)-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indol-8-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 171805442 |
| Molecular Formula | C17H15ClF6N4O |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 1-[4-chloro-2-(2,2,2-trifluoroethoxy)-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indol-8-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccc2c(c1)c1nc(OCC(F)(F)F)nc(Cl)c1n2CC(F)(F)F |
| InChI | InChI=1S/C17H15ClF6N4O/c1-27(2)6-9-3-4-11-10(5-9)12-13(28(11)7-16(19,20)21)14(18)26-15(25-12)29-8-17(22,23)24/h3-5H,6-8H2,1-2H3 |
| InChIKey | APDDASKTUJDMPI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |