C23H19F2N3O5S — CID 171805957
3-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]prop-2-ynyl methanesulfonate (PubChem CID 171805957) has the molecular formula C23H19F2N3O5S and a molecular weight of 490.50 g/mol. Its IUPAC name is 3-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]prop-2-ynyl methanesulfonate.
| Compound Name | 3-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]prop-2-ynyl methanesulfonate |
|---|---|
| PubChem CID | 171805957 |
| Molecular Formula | C23H19F2N3O5S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 3-[(1R,11R)-18-(difluoromethoxy)-13-oxo-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-5-yl]prop-2-ynyl methanesulfonate |
| SMILES | [2H]C([2H])([2H])N1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nc3ccc(C#CCOS(C)(=O)=O)cc3n12 |
| InChI | InChI=1S/C23H19F2N3O5S/c1-27-18-12-17(20-14(22(27)29)6-3-7-19(20)33-23(24)25)28-16-11-13(5-4-10-32-34(2,30)31)8-9-15(16)26-21(18)28/h3,6-9,11,17-18,23H,10,12H2,1-2H3/t17-,18-/m1/s1/i1D3 |
| InChIKey | KXDYYJFFLNBRSQ-MAJHKVOXSA-N |
| XLogP | 3.09 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|