C28H26F2N4O3 — CID 171806085
(1R,11R)-5-[2-(1-acetylpiperidin-3-yl)ethynyl]-18-(difluoromethoxy)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one (PubChem CID 171806085) has the molecular formula C28H26F2N4O3 and a molecular weight of 507.56 g/mol. Its IUPAC name is (1R,11R)-5-[2-(1-acetylpiperidin-3-yl)ethynyl]-18-(difluoromethoxy)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one.
| Compound Name | (1R,11R)-5-[2-(1-acetylpiperidin-3-yl)ethynyl]-18-(difluoromethoxy)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
|---|---|
| PubChem CID | 171806085 |
| Molecular Formula | C28H26F2N4O3 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (1R,11R)-5-[2-(1-acetylpiperidin-3-yl)ethynyl]-18-(difluoromethoxy)-12-(trideuteriomethyl)-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14(19),15,17-heptaen-13-one |
| SMILES | [2H]C([2H])([2H])N1C(=O)c2cccc(OC(F)F)c2[C@H]2C[C@@H]1c1nc3ccc(C#CC4CCCN(C(C)=O)C4)cc3n12 |
| InChI | InChI=1S/C28H26F2N4O3/c1-16(35)33-12-4-5-18(15-33)9-8-17-10-11-20-21(13-17)34-22-14-23(26(34)31-20)32(2)27(36)19-6-3-7-24(25(19)22)37-28(29)30/h3,6-7,10-11,13,18,22-23,28H,4-5,12,14-15H2,1-2H3/t18?,22-,23-/m1/s1/i2D3 |
| InChIKey | KOFOOKRKFSKVKP-WLSJIZFCSA-N |
| XLogP | 4.37 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|