C15H11F3N4OS — CID 171806631
2-methylsulfanyl-6-prop-1-en-2-yl-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one (PubChem CID 171806631) has the molecular formula C15H11F3N4OS and a molecular weight of 352.34 g/mol. Its IUPAC name is 2-methylsulfanyl-6-prop-1-en-2-yl-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-methylsulfanyl-6-prop-1-en-2-yl-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 171806631 |
| Molecular Formula | C15H11F3N4OS |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-methylsulfanyl-6-prop-1-en-2-yl-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one |
| SMILES | C=C(C)c1nc2c(=O)[nH]c(SC)nn2c1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H11F3N4OS/c1-6(2)11-12(7-4-8(16)10(18)9(17)5-7)22-13(19-11)14(23)20-15(21-22)24-3/h4-5H,1H2,2-3H3,(H,20,21,23) |
| InChIKey | AXAHGIUZGQFXEX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|