C19H10F6N4O2 — CID 171806725
6-phenyl-2-(2,2,2-trifluoroethoxy)-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one (PubChem CID 171806725) has the molecular formula C19H10F6N4O2 and a molecular weight of 440.30 g/mol. Its IUPAC name is 6-phenyl-2-(2,2,2-trifluoroethoxy)-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 6-phenyl-2-(2,2,2-trifluoroethoxy)-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 171806725 |
| Molecular Formula | C19H10F6N4O2 |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 6-phenyl-2-(2,2,2-trifluoroethoxy)-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one |
| SMILES | O=c1[nH]c(OCC(F)(F)F)nn2c(-c3cc(F)c(F)c(F)c3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C19H10F6N4O2/c20-11-6-10(7-12(21)13(11)22)15-14(9-4-2-1-3-5-9)26-16-17(30)27-18(28-29(15)16)31-8-19(23,24)25/h1-7H,8H2,(H,27,28,30) |
| InChIKey | LJRWUQXAABPHHN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|