About 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine
5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine (PubChem CID 171806921) has the molecular formula C14H14F3N3O
and a molecular weight of 297.28 g/mol. Its IUPAC name is 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine |
| PubChem CID | 171806921 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(C2CCCCO2)c1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H14F3N3O/c15-8-5-7(6-9(16)12(8)17)11-13(19-20-14(11)18)10-3-1-2-4-21-10/h5-6,10H,1-4H2,(H3,18,19,20) |
| InChIKey | CEWZJQOPDDZSHR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine?
The IUPAC name of 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine (CID 171806921) is 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine.
What is the SMILES notation for 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine?
The canonical SMILES for 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine is Nc1n[nH]c(C2CCCCO2)c1-c1cc(F)c(F)c(F)c1.
What is the InChIKey of 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine?
The InChIKey is CEWZJQOPDDZSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3N3O/c15-8-5-7(6-9(16)12(8)17)11-13(19-20-14(11)18)10-3-1-2-4-21-10/h5-6,10H,1-4H2,(H3,18,19,20).
What are the key properties of 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine?
5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine has a molecular weight of 297.28 g/mol, XLogP of 3.32, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxan-2-yl)-4-(3,4,5-trifluorophenyl)-1H-pyrazol-3-amine is sourced from PubChem (CID 171806921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).