C15H10F6N4OS — CID 171807004
8-(4-fluorophenyl)-7-methyl-2-(2,2,3,3,3-pentafluoropropylsulfanyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one (PubChem CID 171807004) has the molecular formula C15H10F6N4OS and a molecular weight of 408.33 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-7-methyl-2-(2,2,3,3,3-pentafluoropropylsulfanyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one.
| Compound Name | 8-(4-fluorophenyl)-7-methyl-2-(2,2,3,3,3-pentafluoropropylsulfanyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 171807004 |
| Molecular Formula | C15H10F6N4OS |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 8-(4-fluorophenyl)-7-methyl-2-(2,2,3,3,3-pentafluoropropylsulfanyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
| SMILES | Cc1nn2c(=O)[nH]c(SCC(F)(F)C(F)(F)F)nc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10F6N4OS/c1-7-10(8-2-4-9(16)5-3-8)11-22-12(23-13(26)25(11)24-7)27-6-14(17,18)15(19,20)21/h2-5H,6H2,1H3,(H,22,23,26) |
| InChIKey | BSVSKIGRYUZKFB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|