C14H7F7N4O2 — CID 171807155
2-(2,2-difluoroethoxy)-7-(difluoromethyl)-8-(3,4,5-trifluorophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one (PubChem CID 171807155) has the molecular formula C14H7F7N4O2 and a molecular weight of 396.22 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-7-(difluoromethyl)-8-(3,4,5-trifluorophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one.
| Compound Name | 2-(2,2-difluoroethoxy)-7-(difluoromethyl)-8-(3,4,5-trifluorophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 171807155 |
| Molecular Formula | C14H7F7N4O2 |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-7-(difluoromethyl)-8-(3,4,5-trifluorophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
| SMILES | O=c1[nH]c(OCC(F)F)nc2c(-c3cc(F)c(F)c(F)c3)c(C(F)F)nn12 |
| InChI | InChI=1S/C14H7F7N4O2/c15-5-1-4(2-6(16)9(5)19)8-10(11(20)21)24-25-12(8)22-13(23-14(25)26)27-3-7(17)18/h1-2,7,11H,3H2,(H,22,23,26) |
| InChIKey | LXSADWNUQJYPEF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|