C16H36N4S — CID 171807734
5-[amino(propan-2-yl)amino]-3,3,6,6-tetramethyl-2,7-dihydrothiepin-4-amine;propan-2-amine (PubChem CID 171807734) has the molecular formula C16H36N4S and a molecular weight of 316.56 g/mol. Its IUPAC name is 5-[amino(propan-2-yl)amino]-3,3,6,6-tetramethyl-2,7-dihydrothiepin-4-amine;propan-2-amine.
| Compound Name | 5-[amino(propan-2-yl)amino]-3,3,6,6-tetramethyl-2,7-dihydrothiepin-4-amine;propan-2-amine |
|---|---|
| PubChem CID | 171807734 |
| Molecular Formula | C16H36N4S |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.27 |
| IUPAC Name | 5-[amino(propan-2-yl)amino]-3,3,6,6-tetramethyl-2,7-dihydrothiepin-4-amine;propan-2-amine |
| SMILES | CC(C)N.CC(C)N(N)C1=C(N)C(C)(C)CSCC1(C)C |
| InChI | InChI=1S/C13H27N3S.C3H9N/c1-9(2)16(15)11-10(14)12(3,4)7-17-8-13(11,5)6;1-3(2)4/h9H,7-8,14-15H2,1-6H3;3H,4H2,1-2H3 |
| InChIKey | RCRURPBZOYPBGK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|