About 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one
5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one (PubChem CID 171809907) has the molecular formula C10H10BrClN2O
and a molecular weight of 289.56 g/mol. Its IUPAC name is 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one.
Molecular Properties
| Compound Name | 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one |
| PubChem CID | 171809907 |
| Molecular Formula | C10H10BrClN2O |
| Molecular Weight | 289.56 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one |
| SMILES | CN1Cc2c(Br)cc(Cl)cc2N(C)C1=O |
| InChI | InChI=1S/C10H10BrClN2O/c1-13-5-7-8(11)3-6(12)4-9(7)14(2)10(13)15/h3-4H,5H2,1-2H3 |
| InChIKey | MSGZYDUAWPRUHA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one?
The IUPAC name of 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one (CID 171809907) is 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one.
What is the SMILES notation for 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one?
The canonical SMILES for 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one is CN1Cc2c(Br)cc(Cl)cc2N(C)C1=O.
What is the InChIKey of 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one?
The InChIKey is MSGZYDUAWPRUHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrClN2O/c1-13-5-7-8(11)3-6(12)4-9(7)14(2)10(13)15/h3-4H,5H2,1-2H3.
What are the key properties of 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one?
5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one has a molecular weight of 289.56 g/mol, XLogP of 3.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-7-chloro-1,3-dimethyl-4H-quinazolin-2-one is sourced from PubChem (CID 171809907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).