About fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid
fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid (PubChem CID 171810743) has the molecular formula C10H15FmN2O5-
and a molecular weight of 500.24 g/mol. Its IUPAC name is fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid.
Molecular Properties
| Compound Name | fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid |
| PubChem CID | 171810743 |
| Molecular Formula | C10H15FmN2O5- |
| Molecular Weight | 500.24 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid |
| SMILES | C=CCOC(=O)N(C)CC(C)(N[C-]=O)C(=O)O.[Fm] |
| InChI | InChI=1S/C10H15N2O5.Fm/c1-4-5-17-9(16)12(3)6-10(2,8(14)15)11-7-13;/h4H,1,5-6H2,2-3H3,(H,11,13)(H,14,15);/q-1; |
| InChIKey | JKUWWOXJQDVMJI-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid?
The IUPAC name of fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid (CID 171810743) is fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid.
What is the SMILES notation for fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid?
The canonical SMILES for fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid is C=CCOC(=O)N(C)CC(C)(N[C-]=O)C(=O)O.[Fm].
What is the InChIKey of fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid?
The InChIKey is JKUWWOXJQDVMJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N2O5.Fm/c1-4-5-17-9(16)12(3)6-10(2,8(14)15)11-7-13;/h4H,1,5-6H2,2-3H3,(H,11,13)(H,14,15);/q-1;.
What are the key properties of fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid?
fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid has a molecular weight of 500.24 g/mol, XLogP of -0.26, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fermium;2-methyl-3-[methyl(prop-2-enoxycarbonyl)amino]-2-(oxomethylamino)propanoic acid is sourced from PubChem (CID 171810743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).