About ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate
ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate (PubChem CID 171810914) has the molecular formula C15H26N4O2
and a molecular weight of 294.40 g/mol. Its IUPAC name is ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate |
| PubChem CID | 171810914 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate |
| SMILES | CC.CC.COC(=O)c1nn(C)cc1C1=CC(C)=CNN1 |
| InChI | InChI=1S/C11H14N4O2.2C2H6/c1-7-4-9(13-12-5-7)8-6-15(2)14-10(8)11(16)17-3;2*1-2/h4-6,12-13H,1-3H3;2*1-2H3 |
| InChIKey | IJMIZZWVFTVJLZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate?
The IUPAC name of ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate (CID 171810914) is ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate.
What is the SMILES notation for ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate?
The canonical SMILES for ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate is CC.CC.COC(=O)c1nn(C)cc1C1=CC(C)=CNN1.
What is the InChIKey of ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate?
The InChIKey is IJMIZZWVFTVJLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2.2C2H6/c1-7-4-9(13-12-5-7)8-6-15(2)14-10(8)11(16)17-3;2*1-2/h4-6,12-13H,1-3H3;2*1-2H3.
What are the key properties of ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate?
ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate has a molecular weight of 294.40 g/mol, XLogP of 2.61, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazole-3-carboxylate is sourced from PubChem (CID 171810914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).