About ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one
ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one (PubChem CID 171810917) has the molecular formula C14H29N3O2S
and a molecular weight of 303.47 g/mol. Its IUPAC name is ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one.
Molecular Properties
| Compound Name | ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one |
| PubChem CID | 171810917 |
| Molecular Formula | C14H29N3O2S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one |
| SMILES | CC.CC.CC1=CNNC(S(C)=O)=C1.O=C1CCCN1 |
| InChI | InChI=1S/C6H10N2OS.C4H7NO.2C2H6/c1-5-3-6(10(2)9)8-7-4-5;6-4-2-1-3-5-4;2*1-2/h3-4,7-8H,1-2H3;1-3H2,(H,5,6);2*1-2H3 |
| InChIKey | OOKIYOMVUPQQTA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one?
The IUPAC name of ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one (CID 171810917) is ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one.
What is the SMILES notation for ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one?
The canonical SMILES for ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one is CC.CC.CC1=CNNC(S(C)=O)=C1.O=C1CCCN1.
What is the InChIKey of ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one?
The InChIKey is OOKIYOMVUPQQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS.C4H7NO.2C2H6/c1-5-3-6(10(2)9)8-7-4-5;6-4-2-1-3-5-4;2*1-2/h3-4,7-8H,1-2H3;1-3H2,(H,5,6);2*1-2H3.
What are the key properties of ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one?
ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one has a molecular weight of 303.47 g/mol, XLogP of 2.17, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-3-methylsulfinyl-1,2-dihydropyridazine;pyrrolidin-2-one is sourced from PubChem (CID 171810917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).