C10H13F2NO — CID 171811076
(4Z)-6-(2,2-difluoroethoxy)-2-methylhepta-1,4,6-trien-3-imine (PubChem CID 171811076) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is (4Z)-6-(2,2-difluoroethoxy)-2-methylhepta-1,4,6-trien-3-imine.
| Compound Name | (4Z)-6-(2,2-difluoroethoxy)-2-methylhepta-1,4,6-trien-3-imine |
|---|---|
| PubChem CID | 171811076 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (4Z)-6-(2,2-difluoroethoxy)-2-methylhepta-1,4,6-trien-3-imine |
| SMILES | [H]/N=C(/C=C\C(=C)OCC(F)F)C(=C)C |
| InChI | InChI=1S/C10H13F2NO/c1-7(2)9(13)5-4-8(3)14-6-10(11)12/h4-5,10,13H,1,3,6H2,2H3/b5-4-,13-9- |
| InChIKey | WKIPNSXTVYRHOI-CVIOMZKKSA-N |
| XLogP | 2.93 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|