About (3,4-difluoro-2-hydroxyphenyl)azanium;ethane
(3,4-difluoro-2-hydroxyphenyl)azanium;ethane (PubChem CID 171811093) has the molecular formula C8H12F2NO+
and a molecular weight of 176.19 g/mol. Its IUPAC name is (3,4-difluoro-2-hydroxyphenyl)azanium;ethane.
Molecular Properties
| Compound Name | (3,4-difluoro-2-hydroxyphenyl)azanium;ethane |
| PubChem CID | 171811093 |
| Molecular Formula | C8H12F2NO+ |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (3,4-difluoro-2-hydroxyphenyl)azanium;ethane |
| SMILES | CC.[NH3+]c1ccc(F)c(F)c1O |
| InChI | InChI=1S/C6H5F2NO.C2H6/c7-3-1-2-4(9)6(10)5(3)8;1-2/h1-2,10H,9H2;1-2H3/p+1 |
| InChIKey | JGXCUYBOWIFHTQ-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3,4-difluoro-2-hydroxyphenyl)azanium;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluoro-2-hydroxyphenyl)azanium;ethane?
The IUPAC name of (3,4-difluoro-2-hydroxyphenyl)azanium;ethane (CID 171811093) is (3,4-difluoro-2-hydroxyphenyl)azanium;ethane.
What is the SMILES notation for (3,4-difluoro-2-hydroxyphenyl)azanium;ethane?
The canonical SMILES for (3,4-difluoro-2-hydroxyphenyl)azanium;ethane is CC.[NH3+]c1ccc(F)c(F)c1O.
What is the InChIKey of (3,4-difluoro-2-hydroxyphenyl)azanium;ethane?
The InChIKey is JGXCUYBOWIFHTQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H5F2NO.C2H6/c7-3-1-2-4(9)6(10)5(3)8;1-2/h1-2,10H,9H2;1-2H3/p+1.
What are the key properties of (3,4-difluoro-2-hydroxyphenyl)azanium;ethane?
(3,4-difluoro-2-hydroxyphenyl)azanium;ethane has a molecular weight of 176.19 g/mol, XLogP of 1.57, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluoro-2-hydroxyphenyl)azanium;ethane is sourced from PubChem (CID 171811093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).