C18H28O2 — CID 171811105
8-[(3Z,5Z)-7-methylnona-1,3,5-trien-4-yl]-1,4-dioxaspiro[4.5]decane (PubChem CID 171811105) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 8-[(3Z,5Z)-7-methylnona-1,3,5-trien-4-yl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-[(3Z,5Z)-7-methylnona-1,3,5-trien-4-yl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 171811105 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 8-[(3Z,5Z)-7-methylnona-1,3,5-trien-4-yl]-1,4-dioxaspiro[4.5]decane |
| SMILES | C=C/C=C(\C=C/C(C)CC)C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C18H28O2/c1-4-6-16(8-7-15(3)5-2)17-9-11-18(12-10-17)19-13-14-20-18/h4,6-8,15,17H,1,5,9-14H2,2-3H3/b8-7-,16-6+ |
| InChIKey | NPRRFTYUHGMURE-YCGHPLDRSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|