C14H24N2O3 — CID 171811313
(6S)-6-[[(1E,3E)-1-amino-3-tert-butylpenta-1,3-dienoxy]methyl]morpholin-3-one (PubChem CID 171811313) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is (6S)-6-[[(1E,3E)-1-amino-3-tert-butylpenta-1,3-dienoxy]methyl]morpholin-3-one.
| Compound Name | (6S)-6-[[(1E,3E)-1-amino-3-tert-butylpenta-1,3-dienoxy]methyl]morpholin-3-one |
|---|---|
| PubChem CID | 171811313 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (6S)-6-[[(1E,3E)-1-amino-3-tert-butylpenta-1,3-dienoxy]methyl]morpholin-3-one |
| SMILES | C/C=C(\C=C(/N)OC[C@@H]1CNC(=O)CO1)C(C)(C)C |
| InChI | InChI=1S/C14H24N2O3/c1-5-10(14(2,3)4)6-12(15)19-8-11-7-16-13(17)9-18-11/h5-6,11H,7-9,15H2,1-4H3,(H,16,17)/b10-5+,12-6+/t11-/m0/s1 |
| InChIKey | HNTZVUZQJWCTFK-IQYSEMKISA-N |
| XLogP | 1.31 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|