About ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone
ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 171811495) has the molecular formula C16H25N5O
and a molecular weight of 303.41 g/mol. Its IUPAC name is ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 171811495 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CC.CC1=CNNC(c2cn(C)nc2C(=O)N2CCCC2)=C1 |
| InChI | InChI=1S/C14H19N5O.C2H6/c1-10-7-12(16-15-8-10)11-9-18(2)17-13(11)14(20)19-5-3-4-6-19;1-2/h7-9,15-16H,3-6H2,1-2H3;1-2H3 |
| InChIKey | NBDCPIFBISUUAW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone?
The IUPAC name of ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone (CID 171811495) is ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone is CC.CC1=CNNC(c2cn(C)nc2C(=O)N2CCCC2)=C1.
What is the InChIKey of ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone?
The InChIKey is NBDCPIFBISUUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O.C2H6/c1-10-7-12(16-15-8-10)11-9-18(2)17-13(11)14(20)19-5-3-4-6-19;1-2/h7-9,15-16H,3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone?
ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone has a molecular weight of 303.41 g/mol, XLogP of 2.03, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[1-methyl-4-(5-methyl-1,2-dihydropyridazin-3-yl)pyrazol-3-yl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 171811495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).