C11H21N3O2 — CID 171811511
(2Z,4Z)-2,5-diamino-N-(2-hydroxy-2-methylpropyl)-N,4-dimethylpenta-2,4-dienamide (PubChem CID 171811511) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is (2Z,4Z)-2,5-diamino-N-(2-hydroxy-2-methylpropyl)-N,4-dimethylpenta-2,4-dienamide.
| Compound Name | (2Z,4Z)-2,5-diamino-N-(2-hydroxy-2-methylpropyl)-N,4-dimethylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 171811511 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | (2Z,4Z)-2,5-diamino-N-(2-hydroxy-2-methylpropyl)-N,4-dimethylpenta-2,4-dienamide |
| SMILES | CC(=C/N)/C=C(\N)C(=O)N(C)CC(C)(C)O |
| InChI | InChI=1S/C11H21N3O2/c1-8(6-12)5-9(13)10(15)14(4)7-11(2,3)16/h5-6,16H,7,12-13H2,1-4H3/b8-6-,9-5- |
| InChIKey | OGXFOOVFDINYKV-VZPCVYTNSA-N |
| XLogP | -0.08 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|