C38H34F3N11O4 — CID 171811667
[2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] 2-[4-[[4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-5,7-dioxopyrrolo[3,4-b]pyridin-6-yl]methyl]piperidin-1-yl]acetate (PubChem CID 171811667) has the molecular formula C38H34F3N11O4 and a molecular weight of 765.76 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] 2-[4-[[4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-5,7-dioxopyrrolo[3,4-b]pyridin-6-yl]methyl]piperidin-1-yl]acetate.
| Compound Name | [2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] 2-[4-[[4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-5,7-dioxopyrrolo[3,4-b]pyridin-6-yl]methyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 171811667 |
| Molecular Formula | C38H34F3N11O4 |
| Molecular Weight | 765.76 g/mol |
| Exact Mass | 765.27 |
| IUPAC Name | [2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] 2-[4-[[4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-5,7-dioxopyrrolo[3,4-b]pyridin-6-yl]methyl]piperidin-1-yl]acetate |
| SMILES | Cn1cc(-c2ccnc3c2C(=O)N(CC2CCN(CC(=O)OC(Cn4cncn4)(Cn4cncn4)c4ccc(F)cc4F)CC2)C3=O)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C38H34F3N11O4/c1-48-16-29(34(47-48)25-2-4-26(39)5-3-25)28-8-11-44-35-33(28)36(54)52(37(35)55)15-24-9-12-49(13-10-24)17-32(53)56-38(18-50-22-42-20-45-50,19-51-23-43-21-46-51)30-7-6-27(40)14-31(30)41/h2-8,11,14,16,20-24H,9-10,12-13,15,17-19H2,1H3 |
| InChIKey | NUDNCXFQLJMTMF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 159.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|