C34H25FN6O3 — CID 171811702
3-[[2-(4-fluorophenyl)-3-pyridin-4-ylpyrazolo[1,5-a]pyridine-6-carbonyl]amino]propyl 9H-pyrido[3,4-b]indole-1-carboxylate (PubChem CID 171811702) has the molecular formula C34H25FN6O3 and a molecular weight of 584.61 g/mol. Its IUPAC name is 3-[[2-(4-fluorophenyl)-3-pyridin-4-ylpyrazolo[1,5-a]pyridine-6-carbonyl]amino]propyl 9H-pyrido[3,4-b]indole-1-carboxylate.
| Compound Name | 3-[[2-(4-fluorophenyl)-3-pyridin-4-ylpyrazolo[1,5-a]pyridine-6-carbonyl]amino]propyl 9H-pyrido[3,4-b]indole-1-carboxylate |
|---|---|
| PubChem CID | 171811702 |
| Molecular Formula | C34H25FN6O3 |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 3-[[2-(4-fluorophenyl)-3-pyridin-4-ylpyrazolo[1,5-a]pyridine-6-carbonyl]amino]propyl 9H-pyrido[3,4-b]indole-1-carboxylate |
| SMILES | O=C(NCCCOC(=O)c1nccc2c1[nH]c1ccccc12)c1ccc2c(-c3ccncc3)c(-c3ccc(F)cc3)nn2c1 |
| InChI | InChI=1S/C34H25FN6O3/c35-24-9-6-22(7-10-24)30-29(21-12-16-36-17-13-21)28-11-8-23(20-41(28)40-30)33(42)38-15-3-19-44-34(43)32-31-26(14-18-37-32)25-4-1-2-5-27(25)39-31/h1-2,4-14,16-18,20,39H,3,15,19H2,(H,38,42) |
| InChIKey | NBAMUVSJYNOLHW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|