C45H84O5S2 — CID 171811949
1-[11-[2-(3-cyclohexylpropanoyloxy)octylsulfanyl]-6-hydroxyundecyl]sulfanyloctan-2-yl 3-cyclohexylpropanoate (PubChem CID 171811949) has the molecular formula C45H84O5S2 and a molecular weight of 769.30 g/mol. Its IUPAC name is 1-[11-[2-(3-cyclohexylpropanoyloxy)octylsulfanyl]-6-hydroxyundecyl]sulfanyloctan-2-yl 3-cyclohexylpropanoate.
| Compound Name | 1-[11-[2-(3-cyclohexylpropanoyloxy)octylsulfanyl]-6-hydroxyundecyl]sulfanyloctan-2-yl 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 171811949 |
| Molecular Formula | C45H84O5S2 |
| Molecular Weight | 769.30 g/mol |
| Exact Mass | 768.58 |
| IUPAC Name | 1-[11-[2-(3-cyclohexylpropanoyloxy)octylsulfanyl]-6-hydroxyundecyl]sulfanyloctan-2-yl 3-cyclohexylpropanoate |
| SMILES | CCCCCCC(CSCCCCCC(O)CCCCCSCC(CCCCCC)OC(=O)CCC1CCCCC1)OC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C45H84O5S2/c1-3-5-7-19-29-42(49-44(47)33-31-39-23-13-9-14-24-39)37-51-35-21-11-17-27-41(46)28-18-12-22-36-52-38-43(30-20-8-6-4-2)50-45(48)34-32-40-25-15-10-16-26-40/h39-43,46H,3-38H2,1-2H3 |
| InChIKey | MTIRHYRMJKJPGE-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.30 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|