C25H32FNOSi — CID 171812054
tert-butyl-[[(6E)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]-diphenylsilane (PubChem CID 171812054) has the molecular formula C25H32FNOSi and a molecular weight of 409.62 g/mol. Its IUPAC name is tert-butyl-[[(6E)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(6E)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 171812054 |
| Molecular Formula | C25H32FNOSi |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | tert-butyl-[[(6E)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC12CCCN1C/C(=C/F)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32FNOSi/c1-24(2,3)29(22-11-6-4-7-12-22,23-13-8-5-9-14-23)28-20-25-15-10-16-27(25)19-21(17-25)18-26/h4-9,11-14,18H,10,15-17,19-20H2,1-3H3/b21-18+ |
| InChIKey | GBQQDSYZJGVNAM-DYTRJAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|