C6H4BF3N4O2 — CID 171812662
[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]boronic acid (PubChem CID 171812662) has the molecular formula C6H4BF3N4O2 and a molecular weight of 231.93 g/mol. Its IUPAC name is [2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]boronic acid.
| Compound Name | [2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]boronic acid |
|---|---|
| PubChem CID | 171812662 |
| Molecular Formula | C6H4BF3N4O2 |
| Molecular Weight | 231.93 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | [2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]boronic acid |
| SMILES | OB(O)c1cnc2nc(C(F)(F)F)nn2c1 |
| InChI | InChI=1S/C6H4BF3N4O2/c8-6(9,10)4-12-5-11-1-3(7(15)16)2-14(5)13-4/h1-2,15-16H |
| InChIKey | DXRDLCWWDKKVHQ-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.93 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|