C40H23N5OS — CID 171812888
1-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-dibenzothiophen-3-ylbenzimidazole (PubChem CID 171812888) has the molecular formula C40H23N5OS and a molecular weight of 621.73 g/mol. Its IUPAC name is 1-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-dibenzothiophen-3-ylbenzimidazole.
| Compound Name | 1-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-dibenzothiophen-3-ylbenzimidazole |
|---|---|
| PubChem CID | 171812888 |
| Molecular Formula | C40H23N5OS |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 621.16 |
| IUPAC Name | 1-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-dibenzothiophen-3-ylbenzimidazole |
| SMILES | c1ccc(-c2nc(-c3ccc4c(c3)oc3ccccc34)nc(-n3c(-c4ccc5c(c4)sc4ccccc45)nc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C40H23N5OS/c1-2-10-24(11-3-1)37-42-38(25-18-20-28-27-12-4-8-16-33(27)46-34(28)22-25)44-40(43-37)45-32-15-7-6-14-31(32)41-39(45)26-19-21-30-29-13-5-9-17-35(29)47-36(30)23-26/h1-23H |
| InChIKey | QBUXULLHBCDNMO-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |