C27H35F3O3Si — CID 171813177
tert-butyl-[(E)-4-(oxan-2-yloxy)-2-(2,2,2-trifluoroethyl)but-2-enoxy]-diphenylsilane (PubChem CID 171813177) has the molecular formula C27H35F3O3Si and a molecular weight of 492.65 g/mol. Its IUPAC name is tert-butyl-[(E)-4-(oxan-2-yloxy)-2-(2,2,2-trifluoroethyl)but-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-4-(oxan-2-yloxy)-2-(2,2,2-trifluoroethyl)but-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 171813177 |
| Molecular Formula | C27H35F3O3Si |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | tert-butyl-[(E)-4-(oxan-2-yloxy)-2-(2,2,2-trifluoroethyl)but-2-enoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC/C(=C/COC1CCCCO1)CC(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H35F3O3Si/c1-26(2,3)34(23-12-6-4-7-13-23,24-14-8-5-9-15-24)33-21-22(20-27(28,29)30)17-19-32-25-16-10-11-18-31-25/h4-9,12-15,17,25H,10-11,16,18-21H2,1-3H3/b22-17+ |
| InChIKey | BPNFKSJHMFLFEZ-OQKWZONESA-N |
| XLogP | 5.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|