About ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate
ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate (PubChem CID 171813335) has the molecular formula C8H10F2N2O3
and a molecular weight of 220.17 g/mol. Its IUPAC name is ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate |
| PubChem CID | 171813335 |
| Molecular Formula | C8H10F2N2O3 |
| Molecular Weight | 220.17 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(OCC(F)F)n[nH]1 |
| InChI | InChI=1S/C8H10F2N2O3/c1-2-14-8(13)5-3-7(12-11-5)15-4-6(9)10/h3,6H,2,4H2,1H3,(H,11,12) |
| InChIKey | WBKNTXFLDARZQB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate?
The IUPAC name of ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate (CID 171813335) is ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate.
What is the SMILES notation for ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate?
The canonical SMILES for ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate is CCOC(=O)c1cc(OCC(F)F)n[nH]1.
What is the InChIKey of ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate?
The InChIKey is WBKNTXFLDARZQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O3/c1-2-14-8(13)5-3-7(12-11-5)15-4-6(9)10/h3,6H,2,4H2,1H3,(H,11,12).
What are the key properties of ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate?
ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate has a molecular weight of 220.17 g/mol, XLogP of 1.23, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,2-difluoroethoxy)-1H-pyrazole-5-carboxylate is sourced from PubChem (CID 171813335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).