About 4,7-dihydrocyclohepta[d][1,3]dioxine
4,7-dihydrocyclohepta[d][1,3]dioxine (PubChem CID 171814049) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 4,7-dihydrocyclohepta[d][1,3]dioxine.
Molecular Properties
| Compound Name | 4,7-dihydrocyclohepta[d][1,3]dioxine |
| PubChem CID | 171814049 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 4,7-dihydrocyclohepta[d][1,3]dioxine |
| SMILES | C1=CC2=C(C=CC1)OCOC2 |
| InChI | InChI=1S/C9H10O2/c1-2-4-8-6-10-7-11-9(8)5-3-1/h2-5H,1,6-7H2 |
| InChIKey | DKADEIVPVUKTTJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,7-dihydrocyclohepta[d][1,3]dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydrocyclohepta[d][1,3]dioxine?
The IUPAC name of 4,7-dihydrocyclohepta[d][1,3]dioxine (CID 171814049) is 4,7-dihydrocyclohepta[d][1,3]dioxine.
What is the SMILES notation for 4,7-dihydrocyclohepta[d][1,3]dioxine?
The canonical SMILES for 4,7-dihydrocyclohepta[d][1,3]dioxine is C1=CC2=C(C=CC1)OCOC2.
What is the InChIKey of 4,7-dihydrocyclohepta[d][1,3]dioxine?
The InChIKey is DKADEIVPVUKTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-2-4-8-6-10-7-11-9(8)5-3-1/h2-5H,1,6-7H2.
What are the key properties of 4,7-dihydrocyclohepta[d][1,3]dioxine?
4,7-dihydrocyclohepta[d][1,3]dioxine has a molecular weight of 150.18 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydrocyclohepta[d][1,3]dioxine is sourced from PubChem (CID 171814049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).